C19H20N2O2S — CID 170655458
5-ethylsulfanyl-2-[2-(1H-indol-3-yl)ethylamino]benzoic acid (PubChem CID 170655458) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 5-ethylsulfanyl-2-[2-(1H-indol-3-yl)ethylamino]benzoic acid.
| Compound Name | 5-ethylsulfanyl-2-[2-(1H-indol-3-yl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 170655458 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 5-ethylsulfanyl-2-[2-(1H-indol-3-yl)ethylamino]benzoic acid |
| SMILES | CCSc1ccc(NCCc2c[nH]c3ccccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C19H20N2O2S/c1-2-24-14-7-8-18(16(11-14)19(22)23)20-10-9-13-12-21-17-6-4-3-5-15(13)17/h3-8,11-12,20-21H,2,9-10H2,1H3,(H,22,23) |
| InChIKey | VTGGDGPSGWTYBT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |