C19H20N6O2 — CID 170655988
2-anilino-4-(4-methyl-6-morpholin-4-ylpyridazin-3-yl)-1H-pyrimidin-6-one (PubChem CID 170655988) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-anilino-4-(4-methyl-6-morpholin-4-ylpyridazin-3-yl)-1H-pyrimidin-6-one.
| Compound Name | 2-anilino-4-(4-methyl-6-morpholin-4-ylpyridazin-3-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 170655988 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-anilino-4-(4-methyl-6-morpholin-4-ylpyridazin-3-yl)-1H-pyrimidin-6-one |
| SMILES | Cc1cc(N2CCOCC2)nnc1-c1cc(=O)[nH]c(Nc2ccccc2)n1 |
| InChI | InChI=1S/C19H20N6O2/c1-13-11-16(25-7-9-27-10-8-25)23-24-18(13)15-12-17(26)22-19(21-15)20-14-5-3-2-4-6-14/h2-6,11-12H,7-10H2,1H3,(H2,20,21,22,26) |
| InChIKey | SQJBXZJQZZQXRP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |