About 2-[3-ethylsulfonyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetic acid
2-[3-ethylsulfonyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetic acid (PubChem CID 170659360) has the molecular formula C12H11F3N2O4S
and a molecular weight of 336.29 g/mol. Its IUPAC name is 2-[3-ethylsulfonyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-ethylsulfonyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetic acid |
| PubChem CID | 170659360 |
| Molecular Formula | C12H11F3N2O4S |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 2-[3-ethylsulfonyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetic acid |
| SMILES | CCS(=O)(=O)c1c(CC(=O)O)nc2ccc(C(F)(F)F)cn12 |
| InChI | InChI=1S/C12H11F3N2O4S/c1-2-22(20,21)11-8(5-10(18)19)16-9-4-3-7(6-17(9)11)12(13,14)15/h3-4,6H,2,5H2,1H3,(H,18,19) |
| InChIKey | ZYFIDECYUMCCQQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-ethylsulfonyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-ethylsulfonyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetic acid?
The IUPAC name of 2-[3-ethylsulfonyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetic acid (CID 170659360) is 2-[3-ethylsulfonyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetic acid.
What is the SMILES notation for 2-[3-ethylsulfonyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetic acid?
The canonical SMILES for 2-[3-ethylsulfonyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetic acid is CCS(=O)(=O)c1c(CC(=O)O)nc2ccc(C(F)(F)F)cn12.
What is the InChIKey of 2-[3-ethylsulfonyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetic acid?
The InChIKey is ZYFIDECYUMCCQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3N2O4S/c1-2-22(20,21)11-8(5-10(18)19)16-9-4-3-7(6-17(9)11)12(13,14)15/h3-4,6H,2,5H2,1H3,(H,18,19).
What are the key properties of 2-[3-ethylsulfonyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetic acid?
2-[3-ethylsulfonyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetic acid has a molecular weight of 336.29 g/mol, XLogP of 1.77, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-ethylsulfonyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetic acid is sourced from PubChem (CID 170659360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).