C18H13F9N4O2S — CID 170514762
3-ethylsulfonyl-2-[5-[(Z)-2,3,3,4,4,4-hexafluorobut-1-enyl]-1-methylimidazol-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine (PubChem CID 170514762) has the molecular formula C18H13F9N4O2S and a molecular weight of 520.38 g/mol. Its IUPAC name is 3-ethylsulfonyl-2-[5-[(Z)-2,3,3,4,4,4-hexafluorobut-1-enyl]-1-methylimidazol-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine.
| Compound Name | 3-ethylsulfonyl-2-[5-[(Z)-2,3,3,4,4,4-hexafluorobut-1-enyl]-1-methylimidazol-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 170514762 |
| Molecular Formula | C18H13F9N4O2S |
| Molecular Weight | 520.38 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | 3-ethylsulfonyl-2-[5-[(Z)-2,3,3,4,4,4-hexafluorobut-1-enyl]-1-methylimidazol-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine |
| SMILES | CCS(=O)(=O)c1c(-c2ncc(/C=C(\F)C(F)(F)C(F)(F)F)n2C)nc2ccc(C(F)(F)F)cn12 |
| InChI | InChI=1S/C18H13F9N4O2S/c1-3-34(32,33)15-13(29-12-5-4-9(8-31(12)15)17(22,23)24)14-28-7-10(30(14)2)6-11(19)16(20,21)18(25,26)27/h4-8H,3H2,1-2H3/b11-6- |
| InChIKey | KZVMFKTWBNVFCX-WDZFZDKYSA-N |
| XLogP | 5.06 |
| TPSA | 69.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.38 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|