C21H32FNO — CID 170659398
(2S)-1-[(4S)-6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]-2-(methoxymethyl)pyrrolidine (PubChem CID 170659398) has the molecular formula C21H32FNO and a molecular weight of 333.49 g/mol. Its IUPAC name is (2S)-1-[(4S)-6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]-2-(methoxymethyl)pyrrolidine.
| Compound Name | (2S)-1-[(4S)-6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]-2-(methoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 170659398 |
| Molecular Formula | C21H32FNO |
| Molecular Weight | 333.49 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | (2S)-1-[(4S)-6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]-2-(methoxymethyl)pyrrolidine |
| SMILES | COC[C@@H]1CCCN1[C@H](C=C(C)C)CC(C)(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H32FNO/c1-16(2)13-20(23-12-6-7-19(23)15-24-5)14-21(3,4)17-8-10-18(22)11-9-17/h8-11,13,19-20H,6-7,12,14-15H2,1-5H3/t19-,20+/m0/s1 |
| InChIKey | YWJVJGLKYRGBLH-VQTJNVASSA-N |
| XLogP | 4.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|