C45H58IrNO3Si- — CID 170660606
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;trimethyl-[3-methyl-4-[7-(4-pentan-3-yl-1H-naphthalen-1-id-2-yl)furo[2,3-c]pyridin-2-yl]phenyl]silane (PubChem CID 170660606) has the molecular formula C45H58IrNO3Si- and a molecular weight of 881.27 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;trimethyl-[3-methyl-4-[7-(4-pentan-3-yl-1H-naphthalen-1-id-2-yl)furo[2,3-c]pyridin-2-yl]phenyl]silane.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;trimethyl-[3-methyl-4-[7-(4-pentan-3-yl-1H-naphthalen-1-id-2-yl)furo[2,3-c]pyridin-2-yl]phenyl]silane |
|---|---|
| PubChem CID | 170660606 |
| Molecular Formula | C45H58IrNO3Si- |
| Molecular Weight | 881.27 g/mol |
| Exact Mass | 881.38 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;trimethyl-[3-methyl-4-[7-(4-pentan-3-yl-1H-naphthalen-1-id-2-yl)furo[2,3-c]pyridin-2-yl]phenyl]silane |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.CCC(CC)c1cc(-c2nccc3cc(-c4ccc([Si](C)(C)C)cc4C)oc23)[c-]c2ccccc12.[Ir] |
| InChI | InChI=1S/C32H34NOSi.C13H24O2.Ir/c1-7-22(8-2)29-19-25(18-23-11-9-10-12-28(23)29)31-32-24(15-16-33-31)20-30(34-32)27-14-13-26(17-21(27)3)35(4,5)6;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h9-17,19-20,22H,7-8H2,1-6H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | XCYVOQIAHHOVKV-DZTQYQPZSA-N |
| XLogP | 12.74 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.27 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|