About (NZ,1Z)-4-bromo-N-[chloro-(3,5-difluorophenyl)methylidene]-2-fluorobenzenecarbohydrazonoyl chloride
(NZ,1Z)-4-bromo-N-[chloro-(3,5-difluorophenyl)methylidene]-2-fluorobenzenecarbohydrazonoyl chloride (PubChem CID 170665135) has the molecular formula C14H6BrCl2F3N2
and a molecular weight of 410.02 g/mol. Its IUPAC name is (NZ,1Z)-4-bromo-N-[chloro-(3,5-difluorophenyl)methylidene]-2-fluorobenzenecarbohydrazonoyl chloride.
Molecular Properties
| Compound Name | (NZ,1Z)-4-bromo-N-[chloro-(3,5-difluorophenyl)methylidene]-2-fluorobenzenecarbohydrazonoyl chloride |
| PubChem CID | 170665135 |
| Molecular Formula | C14H6BrCl2F3N2 |
| Molecular Weight | 410.02 g/mol |
| Exact Mass | 407.90 |
| IUPAC Name | (NZ,1Z)-4-bromo-N-[chloro-(3,5-difluorophenyl)methylidene]-2-fluorobenzenecarbohydrazonoyl chloride |
| SMILES | Fc1cc(F)cc(/C(Cl)=N/N=C(\Cl)c2ccc(Br)cc2F)c1 |
| InChI | InChI=1S/C14H6BrCl2F3N2/c15-8-1-2-11(12(20)5-8)14(17)22-21-13(16)7-3-9(18)6-10(19)4-7/h1-6H/b21-13-,22-14- |
| InChIKey | KIHJMOYYXBTKIG-JZTLMNBPSA-N |
| XLogP | 5.45 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.02 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ,1Z)-4-bromo-N-[chloro-(3,5-difluorophenyl)methylidene]-2-fluorobenzenecarbohydrazonoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ,1Z)-4-bromo-N-[chloro-(3,5-difluorophenyl)methylidene]-2-fluorobenzenecarbohydrazonoyl chloride?
The IUPAC name of (NZ,1Z)-4-bromo-N-[chloro-(3,5-difluorophenyl)methylidene]-2-fluorobenzenecarbohydrazonoyl chloride (CID 170665135) is (NZ,1Z)-4-bromo-N-[chloro-(3,5-difluorophenyl)methylidene]-2-fluorobenzenecarbohydrazonoyl chloride.
What is the SMILES notation for (NZ,1Z)-4-bromo-N-[chloro-(3,5-difluorophenyl)methylidene]-2-fluorobenzenecarbohydrazonoyl chloride?
The canonical SMILES for (NZ,1Z)-4-bromo-N-[chloro-(3,5-difluorophenyl)methylidene]-2-fluorobenzenecarbohydrazonoyl chloride is Fc1cc(F)cc(/C(Cl)=N/N=C(\Cl)c2ccc(Br)cc2F)c1.
What is the InChIKey of (NZ,1Z)-4-bromo-N-[chloro-(3,5-difluorophenyl)methylidene]-2-fluorobenzenecarbohydrazonoyl chloride?
The InChIKey is KIHJMOYYXBTKIG-JZTLMNBPSA-N. The full InChI is InChI=1S/C14H6BrCl2F3N2/c15-8-1-2-11(12(20)5-8)14(17)22-21-13(16)7-3-9(18)6-10(19)4-7/h1-6H/b21-13-,22-14-.
What are the key properties of (NZ,1Z)-4-bromo-N-[chloro-(3,5-difluorophenyl)methylidene]-2-fluorobenzenecarbohydrazonoyl chloride?
(NZ,1Z)-4-bromo-N-[chloro-(3,5-difluorophenyl)methylidene]-2-fluorobenzenecarbohydrazonoyl chloride has a molecular weight of 410.02 g/mol, XLogP of 5.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ,1Z)-4-bromo-N-[chloro-(3,5-difluorophenyl)methylidene]-2-fluorobenzenecarbohydrazonoyl chloride is sourced from PubChem (CID 170665135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).