About 4-bromo-2-fluoro-1-(1,2,2-trifluoroethenyl)benzene
4-bromo-2-fluoro-1-(1,2,2-trifluoroethenyl)benzene (PubChem CID 139748695) has the molecular formula C8H3BrF4
and a molecular weight of 255.01 g/mol. Its IUPAC name is 4-bromo-2-fluoro-1-(1,2,2-trifluoroethenyl)benzene.
Analyze 4-bromo-2-fluoro-1-(1,2,2-trifluoroethenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-fluoro-1-(1,2,2-trifluoroethenyl)benzene?
The IUPAC name of 4-bromo-2-fluoro-1-(1,2,2-trifluoroethenyl)benzene (CID 139748695) is 4-bromo-2-fluoro-1-(1,2,2-trifluoroethenyl)benzene.
What is the SMILES notation for 4-bromo-2-fluoro-1-(1,2,2-trifluoroethenyl)benzene?
The canonical SMILES for 4-bromo-2-fluoro-1-(1,2,2-trifluoroethenyl)benzene is FC(F)=C(F)c1ccc(Br)cc1F.
What is the InChIKey of 4-bromo-2-fluoro-1-(1,2,2-trifluoroethenyl)benzene?
The InChIKey is WAOQWQBQCJOHSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3BrF4/c9-4-1-2-5(6(10)3-4)7(11)8(12)13/h1-3H.
What are the key properties of 4-bromo-2-fluoro-1-(1,2,2-trifluoroethenyl)benzene?
4-bromo-2-fluoro-1-(1,2,2-trifluoroethenyl)benzene has a molecular weight of 255.01 g/mol, XLogP of 4.12, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-fluoro-1-(1,2,2-trifluoroethenyl)benzene is sourced from PubChem (CID 139748695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).