C26H26N6O4S — CID 170667448
(10E)-10-amino-5-(2,6-dimethylphenyl)-12-methylimino-9,9-dioxo-2-oxa-9λ6-thia-6,8,14,23-tetrazatetracyclo[12.7.1.13,7.016,21]tricosa-3(23),4,6,10,16,18,20-heptaen-13-one (PubChem CID 170667448) has the molecular formula C26H26N6O4S and a molecular weight of 518.60 g/mol. Its IUPAC name is (10E)-10-amino-5-(2,6-dimethylphenyl)-12-methylimino-9,9-dioxo-2-oxa-9λ6-thia-6,8,14,23-tetrazatetracyclo[12.7.1.13,7.016,21]tricosa-3(23),4,6,10,16,18,20-heptaen-13-one.
| Compound Name | (10E)-10-amino-5-(2,6-dimethylphenyl)-12-methylimino-9,9-dioxo-2-oxa-9λ6-thia-6,8,14,23-tetrazatetracyclo[12.7.1.13,7.016,21]tricosa-3(23),4,6,10,16,18,20-heptaen-13-one |
|---|---|
| PubChem CID | 170667448 |
| Molecular Formula | C26H26N6O4S |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | (10E)-10-amino-5-(2,6-dimethylphenyl)-12-methylimino-9,9-dioxo-2-oxa-9λ6-thia-6,8,14,23-tetrazatetracyclo[12.7.1.13,7.016,21]tricosa-3(23),4,6,10,16,18,20-heptaen-13-one |
| SMILES | C/N=C1\C=C(\N)S(=O)(=O)Nc2nc(cc(-c3c(C)cccc3C)n2)OC2CN(Cc3ccccc32)C1=O |
| InChI | InChI=1S/C26H26N6O4S/c1-15-7-6-8-16(2)24(15)19-12-23-30-26(29-19)31-37(34,35)22(27)11-20(28-3)25(33)32-13-17-9-4-5-10-18(17)21(14-32)36-23/h4-12,21H,13-14,27H2,1-3H3,(H,29,30,31)/b22-11-,28-20+ |
| InChIKey | SIKPZXHNDRCALB-WPLARYOYSA-N |
| XLogP | 2.85 |
| TPSA | 139.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|