C21H16ClF3N10O2 — CID 170676999
6-[(6-chloro-2-methylindazol-5-yl)amino]-3-[(2-methyltetrazol-5-yl)methyl]-1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione (PubChem CID 170676999) has the molecular formula C21H16ClF3N10O2 and a molecular weight of 532.87 g/mol. Its IUPAC name is 6-[(6-chloro-2-methylindazol-5-yl)amino]-3-[(2-methyltetrazol-5-yl)methyl]-1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione.
| Compound Name | 6-[(6-chloro-2-methylindazol-5-yl)amino]-3-[(2-methyltetrazol-5-yl)methyl]-1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 170676999 |
| Molecular Formula | C21H16ClF3N10O2 |
| Molecular Weight | 532.87 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | 6-[(6-chloro-2-methylindazol-5-yl)amino]-3-[(2-methyltetrazol-5-yl)methyl]-1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione |
| SMILES | Cn1cc2cc(Nc3nc(=O)n(Cc4nnn(C)n4)c(=O)n3Cc3cc(F)c(F)cc3F)c(Cl)cc2n1 |
| InChI | InChI=1S/C21H16ClF3N10O2/c1-32-7-11-4-17(12(22)5-16(11)29-32)26-19-27-20(36)35(9-18-28-31-33(2)30-18)21(37)34(19)8-10-3-14(24)15(25)6-13(10)23/h3-7H,8-9H2,1-2H3,(H,26,27,36) |
| InChIKey | MSBWYGOWNOOYPK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 130.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.87 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|