C22H17ClF3N7O3 — CID 170677020
6-[(6-chloro-2-methylindazol-5-yl)amino]-3-[(2,5-dideuterio-2,3-dihydro-1,3-oxazol-4-yl)methyl]-1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione (PubChem CID 170677020) has the molecular formula C22H17ClF3N7O3 and a molecular weight of 521.88 g/mol. Its IUPAC name is 6-[(6-chloro-2-methylindazol-5-yl)amino]-3-[(2,5-dideuterio-2,3-dihydro-1,3-oxazol-4-yl)methyl]-1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione.
| Compound Name | 6-[(6-chloro-2-methylindazol-5-yl)amino]-3-[(2,5-dideuterio-2,3-dihydro-1,3-oxazol-4-yl)methyl]-1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 170677020 |
| Molecular Formula | C22H17ClF3N7O3 |
| Molecular Weight | 521.88 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 6-[(6-chloro-2-methylindazol-5-yl)amino]-3-[(2,5-dideuterio-2,3-dihydro-1,3-oxazol-4-yl)methyl]-1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione |
| SMILES | [2H]C1=C(Cn2c(=O)nc(Nc3cc4cn(C)nc4cc3Cl)n(Cc3cc(F)c(F)cc3F)c2=O)NC([2H])O1 |
| InChI | InChI=1S/C22H17ClF3N7O3/c1-31-6-12-3-19(14(23)4-18(12)30-31)28-20-29-21(34)33(8-13-9-36-10-27-13)22(35)32(20)7-11-2-16(25)17(26)5-15(11)24/h2-6,9,27H,7-8,10H2,1H3,(H,28,29,34)/i9D,10D |
| InChIKey | TWJJEODRSZFXOL-QDRJLNDYSA-N |
| XLogP | 2.57 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.88 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|