C23H28N2O2 — CID 170680012
N-[5-methyl-2-(oxan-4-yl)phenyl]-2-phenylpyrrolidine-1-carboxamide (PubChem CID 170680012) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-[5-methyl-2-(oxan-4-yl)phenyl]-2-phenylpyrrolidine-1-carboxamide.
| Compound Name | N-[5-methyl-2-(oxan-4-yl)phenyl]-2-phenylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 170680012 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | N-[5-methyl-2-(oxan-4-yl)phenyl]-2-phenylpyrrolidine-1-carboxamide |
| SMILES | Cc1ccc(C2CCOCC2)c(NC(=O)N2CCCC2c2ccccc2)c1 |
| InChI | InChI=1S/C23H28N2O2/c1-17-9-10-20(18-11-14-27-15-12-18)21(16-17)24-23(26)25-13-5-8-22(25)19-6-3-2-4-7-19/h2-4,6-7,9-10,16,18,22H,5,8,11-15H2,1H3,(H,24,26) |
| InChIKey | HTQVCNFBVXUDPE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |