C14H13F3O4 — CID 170681865
3-(1-methylcyclopent-2-en-1-yl)oxy-4-(trifluoromethoxy)benzoic acid (PubChem CID 170681865) has the molecular formula C14H13F3O4 and a molecular weight of 302.25 g/mol. Its IUPAC name is 3-(1-methylcyclopent-2-en-1-yl)oxy-4-(trifluoromethoxy)benzoic acid.
| Compound Name | 3-(1-methylcyclopent-2-en-1-yl)oxy-4-(trifluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 170681865 |
| Molecular Formula | C14H13F3O4 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 3-(1-methylcyclopent-2-en-1-yl)oxy-4-(trifluoromethoxy)benzoic acid |
| SMILES | CC1(Oc2cc(C(=O)O)ccc2OC(F)(F)F)C=CCC1 |
| InChI | InChI=1S/C14H13F3O4/c1-13(6-2-3-7-13)20-11-8-9(12(18)19)4-5-10(11)21-14(15,16)17/h2,4-6,8H,3,7H2,1H3,(H,18,19) |
| InChIKey | OPHKATLUQOYHNP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|