C12H5F9O5 — CID 170681913
3-(trifluoromethoxy)-4-[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]oxybenzoic acid (PubChem CID 170681913) has the molecular formula C12H5F9O5 and a molecular weight of 400.15 g/mol. Its IUPAC name is 3-(trifluoromethoxy)-4-[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]oxybenzoic acid.
| Compound Name | 3-(trifluoromethoxy)-4-[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 170681913 |
| Molecular Formula | C12H5F9O5 |
| Molecular Weight | 400.15 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 3-(trifluoromethoxy)-4-[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]oxybenzoic acid |
| SMILES | O=C(O)c1ccc(OC(=O)C(C(F)(F)F)C(F)(F)F)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H5F9O5/c13-10(14,15)7(11(16,17)18)9(24)25-5-2-1-4(8(22)23)3-6(5)26-12(19,20)21/h1-3,7H,(H,22,23) |
| InChIKey | YGDXKHDVQXVOSM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.15 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|