C15H6F3I2O6- — CID 170681870
2-[5-carboxy-2-(trifluoromethoxy)phenoxy]carbonyl-4,6-diiodophenolate (PubChem CID 170681870) has the molecular formula C15H6F3I2O6- and a molecular weight of 593.01 g/mol. Its IUPAC name is 2-[5-carboxy-2-(trifluoromethoxy)phenoxy]carbonyl-4,6-diiodophenolate.
| Compound Name | 2-[5-carboxy-2-(trifluoromethoxy)phenoxy]carbonyl-4,6-diiodophenolate |
|---|---|
| PubChem CID | 170681870 |
| Molecular Formula | C15H6F3I2O6- |
| Molecular Weight | 593.01 g/mol |
| Exact Mass | 592.82 |
| IUPAC Name | 2-[5-carboxy-2-(trifluoromethoxy)phenoxy]carbonyl-4,6-diiodophenolate |
| SMILES | O=C(O)c1ccc(OC(F)(F)F)c(OC(=O)c2cc(I)cc(I)c2[O-])c1 |
| InChI | InChI=1S/C15H7F3I2O6/c16-15(17,18)26-10-2-1-6(13(22)23)3-11(10)25-14(24)8-4-7(19)5-9(20)12(8)21/h1-5,21H,(H,22,23)/p-1 |
| InChIKey | CGAFYHUJTWIZNH-UHFFFAOYSA-M |
| XLogP | 3.79 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.01 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|