C62H68B2 — CID 170683900
3,7-ditert-butyl-5-[6-(3,7-ditert-butylbenzo[b][1]benzoborol-5-yl)-3,8-di(propan-2-yl)pyren-1-yl]benzo[b][1]benzoborole (PubChem CID 170683900) has the molecular formula C62H68B2 and a molecular weight of 834.85 g/mol. Its IUPAC name is 3,7-ditert-butyl-5-[6-(3,7-ditert-butylbenzo[b][1]benzoborol-5-yl)-3,8-di(propan-2-yl)pyren-1-yl]benzo[b][1]benzoborole.
| Compound Name | 3,7-ditert-butyl-5-[6-(3,7-ditert-butylbenzo[b][1]benzoborol-5-yl)-3,8-di(propan-2-yl)pyren-1-yl]benzo[b][1]benzoborole |
|---|---|
| PubChem CID | 170683900 |
| Molecular Formula | C62H68B2 |
| Molecular Weight | 834.85 g/mol |
| Exact Mass | 834.55 |
| IUPAC Name | 3,7-ditert-butyl-5-[6-(3,7-ditert-butylbenzo[b][1]benzoborol-5-yl)-3,8-di(propan-2-yl)pyren-1-yl]benzo[b][1]benzoborole |
| SMILES | CC(C)c1cc(B2c3cc(C(C)(C)C)ccc3-c3ccc(C(C)(C)C)cc32)c2ccc3c(C(C)C)cc(B4c5cc(C(C)(C)C)ccc5-c5ccc(C(C)(C)C)cc54)c4ccc1c2c43 |
| InChI | InChI=1S/C62H68B2/c1-35(2)49-33-55(63-51-29-37(59(5,6)7)17-21-41(51)42-22-18-38(30-52(42)63)60(8,9)10)47-28-26-46-50(36(3)4)34-56(48-27-25-45(49)57(47)58(46)48)64-53-31-39(61(11,12)13)19-23-43(53)44-24-20-40(32-54(44)64)62(14,15)16/h17-36H,1-16H3 |
| InChIKey | MDRRQDZRKZKHCZ-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.85 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|