C20H20FN3O5S — CID 170685667
1-(4-fluoro-3-hydroxyphenyl)-5-(4-methylsulfonylpiperazin-1-yl)indole-2-carboxylic acid (PubChem CID 170685667) has the molecular formula C20H20FN3O5S and a molecular weight of 433.46 g/mol. Its IUPAC name is 1-(4-fluoro-3-hydroxyphenyl)-5-(4-methylsulfonylpiperazin-1-yl)indole-2-carboxylic acid.
| Compound Name | 1-(4-fluoro-3-hydroxyphenyl)-5-(4-methylsulfonylpiperazin-1-yl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 170685667 |
| Molecular Formula | C20H20FN3O5S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 1-(4-fluoro-3-hydroxyphenyl)-5-(4-methylsulfonylpiperazin-1-yl)indole-2-carboxylic acid |
| SMILES | CS(=O)(=O)N1CCN(c2ccc3c(c2)cc(C(=O)O)n3-c2ccc(F)c(O)c2)CC1 |
| InChI | InChI=1S/C20H20FN3O5S/c1-30(28,29)23-8-6-22(7-9-23)14-3-5-17-13(10-14)11-18(20(26)27)24(17)15-2-4-16(21)19(25)12-15/h2-5,10-12,25H,6-9H2,1H3,(H,26,27) |
| InChIKey | FWIDKBQIOXHDTD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |