C17H20FN5O3S — CID 169211611
6-fluoro-3-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-1,2-dihydrobenzotriazol-5-ol (PubChem CID 169211611) has the molecular formula C17H20FN5O3S and a molecular weight of 393.44 g/mol. Its IUPAC name is 6-fluoro-3-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-1,2-dihydrobenzotriazol-5-ol.
| Compound Name | 6-fluoro-3-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-1,2-dihydrobenzotriazol-5-ol |
|---|---|
| PubChem CID | 169211611 |
| Molecular Formula | C17H20FN5O3S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 6-fluoro-3-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-1,2-dihydrobenzotriazol-5-ol |
| SMILES | CS(=O)(=O)N1CCN(c2ccc(N3NNc4cc(F)c(O)cc43)cc2)CC1 |
| InChI | InChI=1S/C17H20FN5O3S/c1-27(25,26)22-8-6-21(7-9-22)12-2-4-13(5-3-12)23-16-11-17(24)14(18)10-15(16)19-20-23/h2-5,10-11,19-20,24H,6-9H2,1H3 |
| InChIKey | MIEXVHRMXPKQOL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|