C19H15FO5 — CID 170686155
4-fluoro-3-(2-methyl-4-phenylbut-3-yn-2-yl)oxycarbonyloxybenzoic acid (PubChem CID 170686155) has the molecular formula C19H15FO5 and a molecular weight of 342.32 g/mol. Its IUPAC name is 4-fluoro-3-(2-methyl-4-phenylbut-3-yn-2-yl)oxycarbonyloxybenzoic acid.
| Compound Name | 4-fluoro-3-(2-methyl-4-phenylbut-3-yn-2-yl)oxycarbonyloxybenzoic acid |
|---|---|
| PubChem CID | 170686155 |
| Molecular Formula | C19H15FO5 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 4-fluoro-3-(2-methyl-4-phenylbut-3-yn-2-yl)oxycarbonyloxybenzoic acid |
| SMILES | CC(C)(C#Cc1ccccc1)OC(=O)Oc1cc(C(=O)O)ccc1F |
| InChI | InChI=1S/C19H15FO5/c1-19(2,11-10-13-6-4-3-5-7-13)25-18(23)24-16-12-14(17(21)22)8-9-15(16)20/h3-9,12H,1-2H3,(H,21,22) |
| InChIKey | HWOPSKJKXWPZBE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|