C35H37FN4O4 — CID 170687748
(2R,3S,4aR)-N-(3-cyano-4-methylphenyl)-1-(2-fluoro-6-methylbenzoyl)-2-[4-(oxan-4-ylamino)phenyl]-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine-3-carboxamide (PubChem CID 170687748) has the molecular formula C35H37FN4O4 and a molecular weight of 596.70 g/mol. Its IUPAC name is (2R,3S,4aR)-N-(3-cyano-4-methylphenyl)-1-(2-fluoro-6-methylbenzoyl)-2-[4-(oxan-4-ylamino)phenyl]-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine-3-carboxamide.
| Compound Name | (2R,3S,4aR)-N-(3-cyano-4-methylphenyl)-1-(2-fluoro-6-methylbenzoyl)-2-[4-(oxan-4-ylamino)phenyl]-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170687748 |
| Molecular Formula | C35H37FN4O4 |
| Molecular Weight | 596.70 g/mol |
| Exact Mass | 596.28 |
| IUPAC Name | (2R,3S,4aR)-N-(3-cyano-4-methylphenyl)-1-(2-fluoro-6-methylbenzoyl)-2-[4-(oxan-4-ylamino)phenyl]-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2C[C@H]3COCC3N(C(=O)c3c(C)cccc3F)C2c2ccc(NC3CCOCC3)cc2)cc1C#N |
| InChI | InChI=1S/C35H37FN4O4/c1-21-6-9-28(16-24(21)18-37)39-34(41)29-17-25-19-44-20-31(25)40(35(42)32-22(2)4-3-5-30(32)36)33(29)23-7-10-26(11-8-23)38-27-12-14-43-15-13-27/h3-11,16,25,27,29,31,33,38H,12-15,17,19-20H2,1-2H3,(H,39,41)/t25-,29-,31?,33?/m0/s1 |
| InChIKey | CGIQZUACHMHFCI-OVLGDLFESA-N |
| XLogP | 5.76 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.70 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |