C28H34FN3O3 — CID 174188197
methyl 2-[4-(cyclopentylamino)phenyl]-1-(2-fluoro-6-methylbenzoyl)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine-3-carboxylate (PubChem CID 174188197) has the molecular formula C28H34FN3O3 and a molecular weight of 479.60 g/mol. Its IUPAC name is methyl 2-[4-(cyclopentylamino)phenyl]-1-(2-fluoro-6-methylbenzoyl)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine-3-carboxylate.
| Compound Name | methyl 2-[4-(cyclopentylamino)phenyl]-1-(2-fluoro-6-methylbenzoyl)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 174188197 |
| Molecular Formula | C28H34FN3O3 |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | methyl 2-[4-(cyclopentylamino)phenyl]-1-(2-fluoro-6-methylbenzoyl)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine-3-carboxylate |
| SMILES | COC(=O)C1CC2CNCC2N(C(=O)c2c(C)cccc2F)C1c1ccc(NC2CCCC2)cc1 |
| InChI | InChI=1S/C28H34FN3O3/c1-17-6-5-9-23(29)25(17)27(33)32-24-16-30-15-19(24)14-22(28(34)35-2)26(32)18-10-12-21(13-11-18)31-20-7-3-4-8-20/h5-6,9-13,19-20,22,24,26,30-31H,3-4,7-8,14-16H2,1-2H3 |
| InChIKey | QTDUDESOHXQHSB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |