C35H39FN4O4 — CID 171362461
(4aS,7aS)-2-[4-(cyclopentylamino)phenyl]-1-(2-fluoro-6-methylbenzoyl)-N-(4-formamido-3-hydroxyphenyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-3-carboxamide (PubChem CID 171362461) has the molecular formula C35H39FN4O4 and a molecular weight of 598.72 g/mol. Its IUPAC name is (4aS,7aS)-2-[4-(cyclopentylamino)phenyl]-1-(2-fluoro-6-methylbenzoyl)-N-(4-formamido-3-hydroxyphenyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-3-carboxamide.
| Compound Name | (4aS,7aS)-2-[4-(cyclopentylamino)phenyl]-1-(2-fluoro-6-methylbenzoyl)-N-(4-formamido-3-hydroxyphenyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171362461 |
| Molecular Formula | C35H39FN4O4 |
| Molecular Weight | 598.72 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | (4aS,7aS)-2-[4-(cyclopentylamino)phenyl]-1-(2-fluoro-6-methylbenzoyl)-N-(4-formamido-3-hydroxyphenyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-3-carboxamide |
| SMILES | Cc1cccc(F)c1C(=O)N1C(c2ccc(NC3CCCC3)cc2)C(C(=O)Nc2ccc(NC=O)c(O)c2)C[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C35H39FN4O4/c1-21-6-4-10-28(36)32(21)35(44)40-30-11-5-7-23(30)18-27(34(43)39-26-16-17-29(37-20-41)31(42)19-26)33(40)22-12-14-25(15-13-22)38-24-8-2-3-9-24/h4,6,10,12-17,19-20,23-24,27,30,33,38,42H,2-3,5,7-9,11,18H2,1H3,(H,37,41)(H,39,43)/t23-,27?,30-,33?/m0/s1 |
| InChIKey | XCKCINYGDNZZFB-GQNGKIAXSA-N |
| XLogP | 6.77 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.72 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|