C21H34N2O2 — CID 170689654
1H-imidazol-2-yl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 170689654) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 1H-imidazol-2-yl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 1H-imidazol-2-yl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 170689654 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | 1H-imidazol-2-yl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)Oc1ncc[nH]1 |
| InChI | InChI=1S/C21H34N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(24)25-21-22-18-19-23-21/h6-7,9-10,18-19H,2-5,8,11-17H2,1H3,(H,22,23)/b7-6-,10-9- |
| InChIKey | SGVMCVJFNZZAHZ-HZJYTTRNSA-N |
| XLogP | 6.13 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|