C25H25FN6O4 — CID 170693024
2-[(2S,3S,4R,5R)-5-[6-(benzylamino)-2-(2-fluorophenyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-methylacetamide (PubChem CID 170693024) has the molecular formula C25H25FN6O4 and a molecular weight of 492.51 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-5-[6-(benzylamino)-2-(2-fluorophenyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-methylacetamide.
| Compound Name | 2-[(2S,3S,4R,5R)-5-[6-(benzylamino)-2-(2-fluorophenyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 170693024 |
| Molecular Formula | C25H25FN6O4 |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-5-[6-(benzylamino)-2-(2-fluorophenyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-methylacetamide |
| SMILES | CNC(=O)C[C@@H]1O[C@@H](n2cnc3c(NCc4ccccc4)nc(-c4ccccc4F)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H25FN6O4/c1-27-18(33)11-17-20(34)21(35)25(36-17)32-13-29-19-23(28-12-14-7-3-2-4-8-14)30-22(31-24(19)32)15-9-5-6-10-16(15)26/h2-10,13,17,20-21,25,34-35H,11-12H2,1H3,(H,27,33)(H,28,30,31)/t17-,20+,21+,25+/m0/s1 |
| InChIKey | ALVRMZQYRLIYCY-XXNSQIBZSA-N |
| XLogP | 2.00 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |