C26H29N7O4 — CID 170693027
2-[(2S,3S,4R,5R)-5-[6-(benzylamino)-2-[3-(methylamino)phenyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-methylacetamide (PubChem CID 170693027) has the molecular formula C26H29N7O4 and a molecular weight of 503.56 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-5-[6-(benzylamino)-2-[3-(methylamino)phenyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-methylacetamide.
| Compound Name | 2-[(2S,3S,4R,5R)-5-[6-(benzylamino)-2-[3-(methylamino)phenyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 170693027 |
| Molecular Formula | C26H29N7O4 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-5-[6-(benzylamino)-2-[3-(methylamino)phenyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-N-methylacetamide |
| SMILES | CNC(=O)C[C@@H]1O[C@@H](n2cnc3c(NCc4ccccc4)nc(-c4cccc(NC)c4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H29N7O4/c1-27-17-10-6-9-16(11-17)23-31-24(29-13-15-7-4-3-5-8-15)20-25(32-23)33(14-30-20)26-22(36)21(35)18(37-26)12-19(34)28-2/h3-11,14,18,21-22,26-27,35-36H,12-13H2,1-2H3,(H,28,34)(H,29,31,32)/t18-,21+,22+,26+/m0/s1 |
| InChIKey | BCABZNPHNFENAM-XNZYNNNKSA-N |
| XLogP | 1.90 |
| TPSA | 146.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |