C32H58O13 — CID 170693223
4-[4-(2,3-dihydroxypropanoyl)-1,2-dihydroxy-3-oxotridecan-4-yl]oxy-1,2,6,7-tetrahydroxy-4-nonylheptane-3,5-dione (PubChem CID 170693223) has the molecular formula C32H58O13 and a molecular weight of 650.80 g/mol. Its IUPAC name is 4-[4-(2,3-dihydroxypropanoyl)-1,2-dihydroxy-3-oxotridecan-4-yl]oxy-1,2,6,7-tetrahydroxy-4-nonylheptane-3,5-dione.
| Compound Name | 4-[4-(2,3-dihydroxypropanoyl)-1,2-dihydroxy-3-oxotridecan-4-yl]oxy-1,2,6,7-tetrahydroxy-4-nonylheptane-3,5-dione |
|---|---|
| PubChem CID | 170693223 |
| Molecular Formula | C32H58O13 |
| Molecular Weight | 650.80 g/mol |
| Exact Mass | 650.39 |
| IUPAC Name | 4-[4-(2,3-dihydroxypropanoyl)-1,2-dihydroxy-3-oxotridecan-4-yl]oxy-1,2,6,7-tetrahydroxy-4-nonylheptane-3,5-dione |
| SMILES | CCCCCCCCCC(OC(CCCCCCCCC)(C(=O)C(O)CO)C(=O)C(O)CO)(C(=O)C(O)CO)C(=O)C(O)CO |
| InChI | InChI=1S/C32H58O13/c1-3-5-7-9-11-13-15-17-31(27(41)23(37)19-33,28(42)24(38)20-34)45-32(29(43)25(39)21-35,30(44)26(40)22-36)18-16-14-12-10-8-6-4-2/h23-26,33-40H,3-22H2,1-2H3 |
| InChIKey | BXSKJEQOXNCMTK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 239.35 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.80 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|