C15H27NO4 — CID 170693414
[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] hept-6-enoate (PubChem CID 170693414) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is [(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] hept-6-enoate.
| Compound Name | [(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] hept-6-enoate |
|---|---|
| PubChem CID | 170693414 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | [(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] hept-6-enoate |
| SMILES | C=CCCCCC(=O)OC[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO4/c1-6-7-8-9-10-13(17)19-11-12(2)16-14(18)20-15(3,4)5/h6,12H,1,7-11H2,2-5H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | FAZVOJGCFYVBNP-GFCCVEGCSA-N |
| XLogP | 3.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|