C29H33N7O4 — CID 170695370
[N'-[[4-[[[6-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methoxy]pyrimidin-4-yl]amino]methyl]-3,5-dimethylphenyl]methyl]carbamimidoyl]oxymethyl acetate (PubChem CID 170695370) has the molecular formula C29H33N7O4 and a molecular weight of 543.63 g/mol. Its IUPAC name is [N'-[[4-[[[6-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methoxy]pyrimidin-4-yl]amino]methyl]-3,5-dimethylphenyl]methyl]carbamimidoyl]oxymethyl acetate.
| Compound Name | [N'-[[4-[[[6-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methoxy]pyrimidin-4-yl]amino]methyl]-3,5-dimethylphenyl]methyl]carbamimidoyl]oxymethyl acetate |
|---|---|
| PubChem CID | 170695370 |
| Molecular Formula | C29H33N7O4 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | [N'-[[4-[[[6-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methoxy]pyrimidin-4-yl]amino]methyl]-3,5-dimethylphenyl]methyl]carbamimidoyl]oxymethyl acetate |
| SMILES | CC(=O)OCO/C(N)=N\Cc1cc(C)c(CNc2cc(OCc3cn4cc(C5CC5)ccc4n3)ncn2)c(C)c1 |
| InChI | InChI=1S/C29H33N7O4/c1-18-8-21(11-32-29(30)40-17-39-20(3)37)9-19(2)25(18)12-31-26-10-28(34-16-33-26)38-15-24-14-36-13-23(22-4-5-22)6-7-27(36)35-24/h6-10,13-14,16,22H,4-5,11-12,15,17H2,1-3H3,(H2,30,32)(H,31,33,34) |
| InChIKey | VDAGXDCSXGQQGH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 138.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|