C30H31ClFN9O — CID 170704260
(3R)-3-[[7-(3-amino-8-chloroisoquinolin-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]pyrrolidine-1-carbonitrile (PubChem CID 170704260) has the molecular formula C30H31ClFN9O and a molecular weight of 588.09 g/mol. Its IUPAC name is (3R)-3-[[7-(3-amino-8-chloroisoquinolin-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]pyrrolidine-1-carbonitrile.
| Compound Name | (3R)-3-[[7-(3-amino-8-chloroisoquinolin-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 170704260 |
| Molecular Formula | C30H31ClFN9O |
| Molecular Weight | 588.09 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | (3R)-3-[[7-(3-amino-8-chloroisoquinolin-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]pyrrolidine-1-carbonitrile |
| SMILES | CN(c1nc(OCC23CCCN2CCC3)nc2c(F)c(-c3nc(N)cc4cccc(Cl)c34)ncc12)[C@@H]1CCN(C#N)C1 |
| InChI | InChI=1S/C30H31ClFN9O/c1-39(19-7-12-40(15-19)17-33)28-20-14-35-27(26-23-18(13-22(34)36-26)5-2-6-21(23)31)24(32)25(20)37-29(38-28)42-16-30-8-3-10-41(30)11-4-9-30/h2,5-6,13-14,19H,3-4,7-12,15-16H2,1H3,(H2,34,36)/t19-/m1/s1 |
| InChIKey | BLGIMULURQVMNY-LJQANCHMSA-N |
| XLogP | 4.61 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.09 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|