C15H21IO4S — CID 170705435
2-[3-(5-iodosulfanyloxy-3,3-dimethylpentoxy)phenyl]acetic acid (PubChem CID 170705435) has the molecular formula C15H21IO4S and a molecular weight of 424.30 g/mol. Its IUPAC name is 2-[3-(5-iodosulfanyloxy-3,3-dimethylpentoxy)phenyl]acetic acid.
| Compound Name | 2-[3-(5-iodosulfanyloxy-3,3-dimethylpentoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 170705435 |
| Molecular Formula | C15H21IO4S |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | 2-[3-(5-iodosulfanyloxy-3,3-dimethylpentoxy)phenyl]acetic acid |
| SMILES | CC(C)(CCOSI)CCOc1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C15H21IO4S/c1-15(2,7-9-20-21-16)6-8-19-13-5-3-4-12(10-13)11-14(17)18/h3-5,10H,6-9,11H2,1-2H3,(H,17,18) |
| InChIKey | BUDLOOICFYQJSR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|