C28H35NO3 — CID 170706858
1-[4-[(1S,3R,4S)-3-cyclohexyl-7-hydroxy-1-methyl-3,4-dihydro-1H-isochromen-4-yl]phenyl]piperidine-4-carbaldehyde (PubChem CID 170706858) has the molecular formula C28H35NO3 and a molecular weight of 433.59 g/mol. Its IUPAC name is 1-[4-[(1S,3R,4S)-3-cyclohexyl-7-hydroxy-1-methyl-3,4-dihydro-1H-isochromen-4-yl]phenyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[4-[(1S,3R,4S)-3-cyclohexyl-7-hydroxy-1-methyl-3,4-dihydro-1H-isochromen-4-yl]phenyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 170706858 |
| Molecular Formula | C28H35NO3 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 1-[4-[(1S,3R,4S)-3-cyclohexyl-7-hydroxy-1-methyl-3,4-dihydro-1H-isochromen-4-yl]phenyl]piperidine-4-carbaldehyde |
| SMILES | C[C@@H]1O[C@H](C2CCCCC2)[C@@H](c2ccc(N3CCC(C=O)CC3)cc2)c2ccc(O)cc21 |
| InChI | InChI=1S/C28H35NO3/c1-19-26-17-24(31)11-12-25(26)27(28(32-19)22-5-3-2-4-6-22)21-7-9-23(10-8-21)29-15-13-20(18-30)14-16-29/h7-12,17-20,22,27-28,31H,2-6,13-16H2,1H3/t19-,27-,28+/m0/s1 |
| InChIKey | LHGHCOZZJOSDSK-LVRGLSNDSA-N |
| XLogP | 5.98 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|