C28H28FNO3 — CID 170707029
1-[4-[(3S,4R)-3-(3-fluoro-5-methylphenyl)-7-hydroxy-3,4-dihydro-1H-isochromen-4-yl]phenyl]piperidine-4-carbaldehyde (PubChem CID 170707029) has the molecular formula C28H28FNO3 and a molecular weight of 445.53 g/mol. Its IUPAC name is 1-[4-[(3S,4R)-3-(3-fluoro-5-methylphenyl)-7-hydroxy-3,4-dihydro-1H-isochromen-4-yl]phenyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[4-[(3S,4R)-3-(3-fluoro-5-methylphenyl)-7-hydroxy-3,4-dihydro-1H-isochromen-4-yl]phenyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 170707029 |
| Molecular Formula | C28H28FNO3 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 1-[4-[(3S,4R)-3-(3-fluoro-5-methylphenyl)-7-hydroxy-3,4-dihydro-1H-isochromen-4-yl]phenyl]piperidine-4-carbaldehyde |
| SMILES | Cc1cc(F)cc([C@H]2OCc3cc(O)ccc3[C@H]2c2ccc(N3CCC(C=O)CC3)cc2)c1 |
| InChI | InChI=1S/C28H28FNO3/c1-18-12-21(14-23(29)13-18)28-27(26-7-6-25(32)15-22(26)17-33-28)20-2-4-24(5-3-20)30-10-8-19(16-31)9-11-30/h2-7,12-16,19,27-28,32H,8-11,17H2,1H3/t27-,28-/m1/s1 |
| InChIKey | GQTMZJWGBICCOB-VSGBNLITSA-N |
| XLogP | 5.66 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|