C26H22Cl2FN5O3 — CID 170708726
5-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-6-methoxy-1-(oxan-2-yl)indazol-3-yl]-2-fluoropyridine-3-carbonitrile (PubChem CID 170708726) has the molecular formula C26H22Cl2FN5O3 and a molecular weight of 542.40 g/mol. Its IUPAC name is 5-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-6-methoxy-1-(oxan-2-yl)indazol-3-yl]-2-fluoropyridine-3-carbonitrile.
| Compound Name | 5-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-6-methoxy-1-(oxan-2-yl)indazol-3-yl]-2-fluoropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 170708726 |
| Molecular Formula | C26H22Cl2FN5O3 |
| Molecular Weight | 542.40 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | 5-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-6-methoxy-1-(oxan-2-yl)indazol-3-yl]-2-fluoropyridine-3-carbonitrile |
| SMILES | COc1cc2c(cc1O[C@H](C)c1c(Cl)cncc1Cl)c(-c1cnc(F)c(C#N)c1)nn2C1CCCCO1 |
| InChI | InChI=1S/C26H22Cl2FN5O3/c1-14(24-18(27)12-31-13-19(24)28)37-22-8-17-20(9-21(22)35-2)34(23-5-3-4-6-36-23)33-25(17)16-7-15(10-30)26(29)32-11-16/h7-9,11-14,23H,3-6H2,1-2H3/t14-,23?/m1/s1 |
| InChIKey | CZXFHEBSJFEKPS-PDNQZYNLSA-N |
| XLogP | 6.66 |
| TPSA | 95.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.40 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|