C10H18FN — CID 170709241
(E,2E)-N-ethyl-2-ethylidene-4-fluorohex-3-en-1-amine (PubChem CID 170709241) has the molecular formula C10H18FN and a molecular weight of 171.26 g/mol. Its IUPAC name is (E,2E)-N-ethyl-2-ethylidene-4-fluorohex-3-en-1-amine.
| Compound Name | (E,2E)-N-ethyl-2-ethylidene-4-fluorohex-3-en-1-amine |
|---|---|
| PubChem CID | 170709241 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | (E,2E)-N-ethyl-2-ethylidene-4-fluorohex-3-en-1-amine |
| SMILES | C/C=C(\C=C(\F)CC)CNCC |
| InChI | InChI=1S/C10H18FN/c1-4-9(8-12-6-3)7-10(11)5-2/h4,7,12H,5-6,8H2,1-3H3/b9-4+,10-7+ |
| InChIKey | PJUPCRKZMOXNFK-SXFWLWNESA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|