C21H31NO4 — CID 170710277
ethane;1-(3,4,12-trihydroxy-12-methyl-10-prop-2-enyl-10-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-1-yl)butan-2-one (PubChem CID 170710277) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is ethane;1-(3,4,12-trihydroxy-12-methyl-10-prop-2-enyl-10-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-1-yl)butan-2-one.
| Compound Name | ethane;1-(3,4,12-trihydroxy-12-methyl-10-prop-2-enyl-10-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-1-yl)butan-2-one |
|---|---|
| PubChem CID | 170710277 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | ethane;1-(3,4,12-trihydroxy-12-methyl-10-prop-2-enyl-10-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-1-yl)butan-2-one |
| SMILES | C=CCN1CC2(CC(=O)CC)c3c(ccc(O)c3O)CC1C2(C)O.CC |
| InChI | InChI=1S/C19H25NO4.C2H6/c1-4-8-20-11-19(10-13(21)5-2)16-12(6-7-14(22)17(16)23)9-15(20)18(19,3)24;1-2/h4,6-7,15,22-24H,1,5,8-11H2,2-3H3;1-2H3 |
| InChIKey | IAIAARCVBBUREC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|