C18H25NO2 — CID 90673013
(1S,9R,13S)-10-ethyl-13-methyl-1-prop-2-enyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4,13-diol (PubChem CID 90673013) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is (1S,9R,13S)-10-ethyl-13-methyl-1-prop-2-enyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4,13-diol.
| Compound Name | (1S,9R,13S)-10-ethyl-13-methyl-1-prop-2-enyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4,13-diol |
|---|---|
| PubChem CID | 90673013 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | (1S,9R,13S)-10-ethyl-13-methyl-1-prop-2-enyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4,13-diol |
| SMILES | C=CC[C@]12CCN(CC)[C@H](Cc3ccc(O)cc31)[C@@]2(C)O |
| InChI | InChI=1S/C18H25NO2/c1-4-8-18-9-10-19(5-2)16(17(18,3)21)11-13-6-7-14(20)12-15(13)18/h4,6-7,12,16,20-21H,1,5,8-11H2,2-3H3/t16-,17-,18+/m1/s1 |
| InChIKey | RDLJUUFRETUETF-KURKYZTESA-N |
| XLogP | 2.61 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|