C20H29NO4 — CID 142943163
13-methoxy-1-[(E)-2-methoxybut-2-enyl]-10,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-3,4-diol (PubChem CID 142943163) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is 13-methoxy-1-[(E)-2-methoxybut-2-enyl]-10,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-3,4-diol.
| Compound Name | 13-methoxy-1-[(E)-2-methoxybut-2-enyl]-10,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-3,4-diol |
|---|---|
| PubChem CID | 142943163 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 13-methoxy-1-[(E)-2-methoxybut-2-enyl]-10,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-3,4-diol |
| SMILES | C/C=C(\CC12CCN(C)C(Cc3ccc(O)c(O)c31)C2(C)OC)OC |
| InChI | InChI=1S/C20H29NO4/c1-6-14(24-4)12-20-9-10-21(3)16(19(20,2)25-5)11-13-7-8-15(22)18(23)17(13)20/h6-8,16,22-23H,9-12H2,1-5H3/b14-6+ |
| InChIKey | SDZGRWMRACRBEA-MKMNVTDBSA-N |
| XLogP | 2.94 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|