C12H20BrNO2 — CID 170711234
4-[2-[(2Z,4E)-4-bromohexa-2,4-dienoxy]ethyl]morpholine (PubChem CID 170711234) has the molecular formula C12H20BrNO2 and a molecular weight of 290.20 g/mol. Its IUPAC name is 4-[2-[(2Z,4E)-4-bromohexa-2,4-dienoxy]ethyl]morpholine.
| Compound Name | 4-[2-[(2Z,4E)-4-bromohexa-2,4-dienoxy]ethyl]morpholine |
|---|---|
| PubChem CID | 170711234 |
| Molecular Formula | C12H20BrNO2 |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 4-[2-[(2Z,4E)-4-bromohexa-2,4-dienoxy]ethyl]morpholine |
| SMILES | C/C=C(Br)\C=C/COCCN1CCOCC1 |
| InChI | InChI=1S/C12H20BrNO2/c1-2-12(13)4-3-8-15-9-5-14-6-10-16-11-7-14/h2-4H,5-11H2,1H3/b4-3-,12-2+ |
| InChIKey | OQEMPZVAEOTXMD-RMVVDNNJSA-N |
| XLogP | 2.19 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|