C19H18N4O — CID 170712450
2-(5-methoxybenzimidazol-1-yl)-N,N-dimethylquinolin-8-amine (PubChem CID 170712450) has the molecular formula C19H18N4O and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-(5-methoxybenzimidazol-1-yl)-N,N-dimethylquinolin-8-amine.
| Compound Name | 2-(5-methoxybenzimidazol-1-yl)-N,N-dimethylquinolin-8-amine |
|---|---|
| PubChem CID | 170712450 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-(5-methoxybenzimidazol-1-yl)-N,N-dimethylquinolin-8-amine |
| SMILES | COc1ccc2c(c1)ncn2-c1ccc2cccc(N(C)C)c2n1 |
| InChI | InChI=1S/C19H18N4O/c1-22(2)17-6-4-5-13-7-10-18(21-19(13)17)23-12-20-15-11-14(24-3)8-9-16(15)23/h4-12H,1-3H3 |
| InChIKey | WSKUFFJTGSDFMY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |