About 2-methoxy-N,N-dimethylquinolin-8-amine
2-methoxy-N,N-dimethylquinolin-8-amine (PubChem CID 137448906) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-methoxy-N,N-dimethylquinolin-8-amine.
Molecular Properties
| Compound Name | 2-methoxy-N,N-dimethylquinolin-8-amine |
| PubChem CID | 137448906 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-methoxy-N,N-dimethylquinolin-8-amine |
| SMILES | COc1ccc2cccc(N(C)C)c2n1 |
| InChI | InChI=1S/C12H14N2O/c1-14(2)10-6-4-5-9-7-8-11(15-3)13-12(9)10/h4-8H,1-3H3 |
| InChIKey | OTCXDHHDVWJQMI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-N,N-dimethylquinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N,N-dimethylquinolin-8-amine?
The IUPAC name of 2-methoxy-N,N-dimethylquinolin-8-amine (CID 137448906) is 2-methoxy-N,N-dimethylquinolin-8-amine.
What is the SMILES notation for 2-methoxy-N,N-dimethylquinolin-8-amine?
The canonical SMILES for 2-methoxy-N,N-dimethylquinolin-8-amine is COc1ccc2cccc(N(C)C)c2n1.
What is the InChIKey of 2-methoxy-N,N-dimethylquinolin-8-amine?
The InChIKey is OTCXDHHDVWJQMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c1-14(2)10-6-4-5-9-7-8-11(15-3)13-12(9)10/h4-8H,1-3H3.
What are the key properties of 2-methoxy-N,N-dimethylquinolin-8-amine?
2-methoxy-N,N-dimethylquinolin-8-amine has a molecular weight of 202.26 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N,N-dimethylquinolin-8-amine is sourced from PubChem (CID 137448906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).