C11H12N2O2 — CID 86241566
2,7-dimethoxyquinolin-8-amine (PubChem CID 86241566) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 2,7-dimethoxyquinolin-8-amine.
| Compound Name | 2,7-dimethoxyquinolin-8-amine |
|---|---|
| PubChem CID | 86241566 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2,7-dimethoxyquinolin-8-amine |
| SMILES | COc1ccc2ccc(OC)c(N)c2n1 |
| InChI | InChI=1S/C11H12N2O2/c1-14-8-5-3-7-4-6-9(15-2)13-11(7)10(8)12/h3-6H,12H2,1-2H3 |
| InChIKey | UGYSCBTYIORDIE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|