C27H26N4O2 — CID 22226916
4-[2-[5-[3-(dimethylamino)propoxy]benzimidazol-1-yl]quinolin-8-yl]phenol (PubChem CID 22226916) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 4-[2-[5-[3-(dimethylamino)propoxy]benzimidazol-1-yl]quinolin-8-yl]phenol.
| Compound Name | 4-[2-[5-[3-(dimethylamino)propoxy]benzimidazol-1-yl]quinolin-8-yl]phenol |
|---|---|
| PubChem CID | 22226916 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 4-[2-[5-[3-(dimethylamino)propoxy]benzimidazol-1-yl]quinolin-8-yl]phenol |
| SMILES | CN(C)CCCOc1ccc2c(c1)ncn2-c1ccc2cccc(-c3ccc(O)cc3)c2n1 |
| InChI | InChI=1S/C27H26N4O2/c1-30(2)15-4-16-33-22-12-13-25-24(17-22)28-18-31(25)26-14-9-20-5-3-6-23(27(20)29-26)19-7-10-21(32)11-8-19/h3,5-14,17-18,32H,4,15-16H2,1-2H3 |
| InChIKey | ZCIMJNMVKBSSNV-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|