C19H25Cl2N3O — CID 22004137
N,N-dimethyl-4-(1-phenylbenzimidazol-5-yl)oxybutan-1-amine;dihydrochloride (PubChem CID 22004137) has the molecular formula C19H25Cl2N3O and a molecular weight of 382.34 g/mol. Its IUPAC name is N,N-dimethyl-4-(1-phenylbenzimidazol-5-yl)oxybutan-1-amine;dihydrochloride.
| Compound Name | N,N-dimethyl-4-(1-phenylbenzimidazol-5-yl)oxybutan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 22004137 |
| Molecular Formula | C19H25Cl2N3O |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N,N-dimethyl-4-(1-phenylbenzimidazol-5-yl)oxybutan-1-amine;dihydrochloride |
| SMILES | CN(C)CCCCOc1ccc2c(c1)ncn2-c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C19H23N3O.2ClH/c1-21(2)12-6-7-13-23-17-10-11-19-18(14-17)20-15-22(19)16-8-4-3-5-9-16;;/h3-5,8-11,14-15H,6-7,12-13H2,1-2H3;2*1H |
| InChIKey | UBQQXYIKBHOVIT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|