C21H19N3O3S — CID 170717544
2-[4-(1-formamidobutyl)phenyl]imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid (PubChem CID 170717544) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is 2-[4-(1-formamidobutyl)phenyl]imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid.
| Compound Name | 2-[4-(1-formamidobutyl)phenyl]imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 170717544 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 2-[4-(1-formamidobutyl)phenyl]imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid |
| SMILES | CCCC(NC=O)c1ccc(-c2cn3c(n2)sc2cc(C(=O)O)ccc23)cc1 |
| InChI | InChI=1S/C21H19N3O3S/c1-2-3-16(22-12-25)13-4-6-14(7-5-13)17-11-24-18-9-8-15(20(26)27)10-19(18)28-21(24)23-17/h4-12,16H,2-3H2,1H3,(H,22,25)(H,26,27) |
| InChIKey | LJEIQLAABCLGIL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|