C13H6BrF3N4O2 — CID 170720062
6-bromo-N-[5-cyano-3-(trifluoromethoxy)-2-pyridinyl]pyridine-2-carboxamide (PubChem CID 170720062) has the molecular formula C13H6BrF3N4O2 and a molecular weight of 387.12 g/mol. Its IUPAC name is 6-bromo-N-[5-cyano-3-(trifluoromethoxy)-2-pyridinyl]pyridine-2-carboxamide.
| Compound Name | 6-bromo-N-[5-cyano-3-(trifluoromethoxy)-2-pyridinyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 170720062 |
| Molecular Formula | C13H6BrF3N4O2 |
| Molecular Weight | 387.12 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | 6-bromo-N-[5-cyano-3-(trifluoromethoxy)-2-pyridinyl]pyridine-2-carboxamide |
| SMILES | N#Cc1cnc(NC(=O)c2cccc(Br)n2)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H6BrF3N4O2/c14-10-3-1-2-8(20-10)12(22)21-11-9(23-13(15,16)17)4-7(5-18)6-19-11/h1-4,6H,(H,19,21,22) |
| InChIKey | FGXGNBVMCMGXTG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.12 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|