C13H9BrF3N5O3 — CID 174162185
6-bromo-N-[5-(N'-hydroxycarbamimidoyl)-3-(trifluoromethoxy)-2-pyridinyl]pyridine-2-carboxamide (PubChem CID 174162185) has the molecular formula C13H9BrF3N5O3 and a molecular weight of 420.15 g/mol. Its IUPAC name is 6-bromo-N-[5-(N'-hydroxycarbamimidoyl)-3-(trifluoromethoxy)-2-pyridinyl]pyridine-2-carboxamide.
| Compound Name | 6-bromo-N-[5-(N'-hydroxycarbamimidoyl)-3-(trifluoromethoxy)-2-pyridinyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 174162185 |
| Molecular Formula | C13H9BrF3N5O3 |
| Molecular Weight | 420.15 g/mol |
| Exact Mass | 418.98 |
| IUPAC Name | 6-bromo-N-[5-(N'-hydroxycarbamimidoyl)-3-(trifluoromethoxy)-2-pyridinyl]pyridine-2-carboxamide |
| SMILES | NC(=NO)c1cnc(NC(=O)c2cccc(Br)n2)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H9BrF3N5O3/c14-9-3-1-2-7(20-9)12(23)21-11-8(25-13(15,16)17)4-6(5-19-11)10(18)22-24/h1-5,24H,(H2,18,22)(H,19,21,23) |
| InChIKey | UGFVMRVSHDDXTQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.15 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|