C26H28F5N3O3 — CID 170720255
2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N-[4-(3-bicyclo[3.1.0]hexanyloxy)-3,5-difluorophenyl]-5-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxamide (PubChem CID 170720255) has the molecular formula C26H28F5N3O3 and a molecular weight of 525.52 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N-[4-(3-bicyclo[3.1.0]hexanyloxy)-3,5-difluorophenyl]-5-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N-[4-(3-bicyclo[3.1.0]hexanyloxy)-3,5-difluorophenyl]-5-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 170720255 |
| Molecular Formula | C26H28F5N3O3 |
| Molecular Weight | 525.52 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N-[4-(3-bicyclo[3.1.0]hexanyloxy)-3,5-difluorophenyl]-5-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1cc(F)c(OC2CC3CC3C2)c(F)c1)c1nc(N2CCC3CCCCC32)oc1CC(F)(F)F |
| InChI | InChI=1S/C26H28F5N3O3/c27-18-10-16(11-19(28)23(18)36-17-8-14-7-15(14)9-17)32-24(35)22-21(12-26(29,30)31)37-25(33-22)34-6-5-13-3-1-2-4-20(13)34/h10-11,13-15,17,20H,1-9,12H2,(H,32,35) |
| InChIKey | YIAMNDNBSWEAFJ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |