C23H24F5N3O3 — CID 171579671
N-[4-(2-bicyclo[3.1.0]hexanyloxy)-3,5-difluorophenyl]-2-(3,3-dimethylazetidin-1-yl)-5-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxamide (PubChem CID 171579671) has the molecular formula C23H24F5N3O3 and a molecular weight of 485.45 g/mol. Its IUPAC name is N-[4-(2-bicyclo[3.1.0]hexanyloxy)-3,5-difluorophenyl]-2-(3,3-dimethylazetidin-1-yl)-5-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-[4-(2-bicyclo[3.1.0]hexanyloxy)-3,5-difluorophenyl]-2-(3,3-dimethylazetidin-1-yl)-5-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 171579671 |
| Molecular Formula | C23H24F5N3O3 |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | N-[4-(2-bicyclo[3.1.0]hexanyloxy)-3,5-difluorophenyl]-2-(3,3-dimethylazetidin-1-yl)-5-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxamide |
| SMILES | CC1(C)CN(c2nc(C(=O)Nc3cc(F)c(OC4CCC5CC54)c(F)c3)c(CC(F)(F)F)o2)C1 |
| InChI | InChI=1S/C23H24F5N3O3/c1-22(2)9-31(10-22)21-30-18(17(34-21)8-23(26,27)28)20(32)29-12-6-14(24)19(15(25)7-12)33-16-4-3-11-5-13(11)16/h6-7,11,13,16H,3-5,8-10H2,1-2H3,(H,29,32) |
| InChIKey | PLGGEHHDJKCRID-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |