C25H28F5N3O3 — CID 170720481
N-[4-(3-bicyclo[3.1.0]hexanyloxy)-3,5-difluorophenyl]-2-(3,3-diethylazetidin-1-yl)-5-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxamide (PubChem CID 170720481) has the molecular formula C25H28F5N3O3 and a molecular weight of 513.51 g/mol. Its IUPAC name is N-[4-(3-bicyclo[3.1.0]hexanyloxy)-3,5-difluorophenyl]-2-(3,3-diethylazetidin-1-yl)-5-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-[4-(3-bicyclo[3.1.0]hexanyloxy)-3,5-difluorophenyl]-2-(3,3-diethylazetidin-1-yl)-5-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 170720481 |
| Molecular Formula | C25H28F5N3O3 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | N-[4-(3-bicyclo[3.1.0]hexanyloxy)-3,5-difluorophenyl]-2-(3,3-diethylazetidin-1-yl)-5-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxamide |
| SMILES | CCC1(CC)CN(c2nc(C(=O)Nc3cc(F)c(OC4CC5CC5C4)c(F)c3)c(CC(F)(F)F)o2)C1 |
| InChI | InChI=1S/C25H28F5N3O3/c1-3-24(4-2)11-33(12-24)23-32-20(19(36-23)10-25(28,29)30)22(34)31-15-8-17(26)21(18(27)9-15)35-16-6-13-5-14(13)7-16/h8-9,13-14,16H,3-7,10-12H2,1-2H3,(H,31,34) |
| InChIKey | QFTXVPXTBXQJIJ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |