C19H23N5O2S — CID 170721739
N-[(3Z)-4-cyanohexa-3,5-dien-3-yl]-2-methyl-6-(morpholin-4-ylmethyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 170721739) has the molecular formula C19H23N5O2S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-[(3Z)-4-cyanohexa-3,5-dien-3-yl]-2-methyl-6-(morpholin-4-ylmethyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | N-[(3Z)-4-cyanohexa-3,5-dien-3-yl]-2-methyl-6-(morpholin-4-ylmethyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 170721739 |
| Molecular Formula | C19H23N5O2S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[(3Z)-4-cyanohexa-3,5-dien-3-yl]-2-methyl-6-(morpholin-4-ylmethyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | C=C/C(C#N)=C(\CC)NC(=O)c1[nH]c2nc(C)sc2c1CN1CCOCC1 |
| InChI | InChI=1S/C19H23N5O2S/c1-4-13(10-20)15(5-2)22-19(25)16-14(11-24-6-8-26-9-7-24)17-18(23-16)21-12(3)27-17/h4,23H,1,5-9,11H2,2-3H3,(H,22,25)/b15-13- |
| InChIKey | ZXLHJIQYTVFHOZ-SQFISAMPSA-N |
| XLogP | 2.87 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|